![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| Adventures of Square/ | 2015-03-27 04:52 | - | |
| Back to Saturn X/ | 2013-07-31 12:17 | - | |
| Compound Fracture/ | 2012-07-08 01:34 | - | |
| Fusion Mapping/ | 2013-02-02 08:36 | - | |
| HacX 2.0/ | 2012-11-06 21:05 | - | |
| Harvester/ | 2012-08-13 11:57 | - | |
| Rebirth MIDI Pack/ | 2017-03-04 22:20 | - | |
| Scattered Evil/ | 2012-07-08 01:34 | - | |
| Supplice/ | 2015-01-26 04:05 | - | |
| TNT2/ | 2014-01-25 22:07 | - | |
| The Lunar Republic/ | 2013-02-04 10:37 | - | |
| Time's Edge/ | 2012-07-08 01:34 | - | |
| Trauma/ | 2012-08-16 08:09 | - | |